C25H40F3NO4Si — CID 139768114
diethyl 2-amino-2-[2-[4-[5-[dimethyl(3,3,3-trifluoropropyl)silyl]pentyl]phenyl]ethyl]propanedioate (PubChem CID 139768114) has the molecular formula C25H40F3NO4Si and a molecular weight of 503.68 g/mol. Its IUPAC name is diethyl 2-amino-2-[2-[4-[5-[dimethyl(3,3,3-trifluoropropyl)silyl]pentyl]phenyl]ethyl]propanedioate.
| Compound Name | diethyl 2-amino-2-[2-[4-[5-[dimethyl(3,3,3-trifluoropropyl)silyl]pentyl]phenyl]ethyl]propanedioate |
|---|---|
| PubChem CID | 139768114 |
| Molecular Formula | C25H40F3NO4Si |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | diethyl 2-amino-2-[2-[4-[5-[dimethyl(3,3,3-trifluoropropyl)silyl]pentyl]phenyl]ethyl]propanedioate |
| SMILES | CCOC(=O)C(N)(CCc1ccc(CCCCC[Si](C)(C)CCC(F)(F)F)cc1)C(=O)OCC |
| InChI | InChI=1S/C25H40F3NO4Si/c1-5-32-22(30)24(29,23(31)33-6-2)16-15-21-13-11-20(12-14-21)10-8-7-9-18-34(3,4)19-17-25(26,27)28/h11-14H,5-10,15-19,29H2,1-4H3 |
| InChIKey | XKJDLXWQNOJGCV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|