C31H39F3N2O3Si — CID 20726298
[4-[5-[4-[dimethyl(3,3,3-trifluoropropyl)silyl]butoxy]pyrimidin-2-yl]phenyl] 4-pentylbenzoate (PubChem CID 20726298) has the molecular formula C31H39F3N2O3Si and a molecular weight of 572.74 g/mol. Its IUPAC name is [4-[5-[4-[dimethyl(3,3,3-trifluoropropyl)silyl]butoxy]pyrimidin-2-yl]phenyl] 4-pentylbenzoate.
| Compound Name | [4-[5-[4-[dimethyl(3,3,3-trifluoropropyl)silyl]butoxy]pyrimidin-2-yl]phenyl] 4-pentylbenzoate |
|---|---|
| PubChem CID | 20726298 |
| Molecular Formula | C31H39F3N2O3Si |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | [4-[5-[4-[dimethyl(3,3,3-trifluoropropyl)silyl]butoxy]pyrimidin-2-yl]phenyl] 4-pentylbenzoate |
| SMILES | CCCCCc1ccc(C(=O)Oc2ccc(-c3ncc(OCCCC[Si](C)(C)CCC(F)(F)F)cn3)cc2)cc1 |
| InChI | InChI=1S/C31H39F3N2O3Si/c1-4-5-6-9-24-10-12-26(13-11-24)30(37)39-27-16-14-25(15-17-27)29-35-22-28(23-36-29)38-19-7-8-20-40(2,3)21-18-31(32,33)34/h10-17,22-23H,4-9,18-21H2,1-3H3 |
| InChIKey | PKKAOXNUFABIFE-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|