C27H41F3N2OSi — CID 20726337
dimethyl-[4-[4-(5-octylpyrimidin-2-yl)phenoxy]butyl]-(3,3,3-trifluoropropyl)silane (PubChem CID 20726337) has the molecular formula C27H41F3N2OSi and a molecular weight of 494.72 g/mol. Its IUPAC name is dimethyl-[4-[4-(5-octylpyrimidin-2-yl)phenoxy]butyl]-(3,3,3-trifluoropropyl)silane.
| Compound Name | dimethyl-[4-[4-(5-octylpyrimidin-2-yl)phenoxy]butyl]-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 20726337 |
| Molecular Formula | C27H41F3N2OSi |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | dimethyl-[4-[4-(5-octylpyrimidin-2-yl)phenoxy]butyl]-(3,3,3-trifluoropropyl)silane |
| SMILES | CCCCCCCCc1cnc(-c2ccc(OCCCC[Si](C)(C)CCC(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C27H41F3N2OSi/c1-4-5-6-7-8-9-12-23-21-31-26(32-22-23)24-13-15-25(16-14-24)33-18-10-11-19-34(2,3)20-17-27(28,29)30/h13-16,21-22H,4-12,17-20H2,1-3H3 |
| InChIKey | LNEYEHGNBIJUTD-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|