C27H42N2O — CID 67902868
2-[4-(3,3-dimethylheptoxy)phenyl]-5-octylpyrimidine (PubChem CID 67902868) has the molecular formula C27H42N2O and a molecular weight of 410.65 g/mol. Its IUPAC name is 2-[4-(3,3-dimethylheptoxy)phenyl]-5-octylpyrimidine.
| Compound Name | 2-[4-(3,3-dimethylheptoxy)phenyl]-5-octylpyrimidine |
|---|---|
| PubChem CID | 67902868 |
| Molecular Formula | C27H42N2O |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.33 |
| IUPAC Name | 2-[4-(3,3-dimethylheptoxy)phenyl]-5-octylpyrimidine |
| SMILES | CCCCCCCCc1cnc(-c2ccc(OCCC(C)(C)CCCC)cc2)nc1 |
| InChI | InChI=1S/C27H42N2O/c1-5-7-9-10-11-12-13-23-21-28-26(29-22-23)24-14-16-25(17-15-24)30-20-19-27(3,4)18-8-6-2/h14-17,21-22H,5-13,18-20H2,1-4H3 |
| InChIKey | OCLZWCRIDOYWDY-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|