C32H56N2OSi2 — CID 22677041
dimethyl-[8-[4-(5-octylpyrimidin-2-yl)phenoxy]octyl]-(trimethylsilylmethyl)silane (PubChem CID 22677041) has the molecular formula C32H56N2OSi2 and a molecular weight of 540.99 g/mol. Its IUPAC name is dimethyl-[8-[4-(5-octylpyrimidin-2-yl)phenoxy]octyl]-(trimethylsilylmethyl)silane.
| Compound Name | dimethyl-[8-[4-(5-octylpyrimidin-2-yl)phenoxy]octyl]-(trimethylsilylmethyl)silane |
|---|---|
| PubChem CID | 22677041 |
| Molecular Formula | C32H56N2OSi2 |
| Molecular Weight | 540.99 g/mol |
| Exact Mass | 540.39 |
| IUPAC Name | dimethyl-[8-[4-(5-octylpyrimidin-2-yl)phenoxy]octyl]-(trimethylsilylmethyl)silane |
| SMILES | CCCCCCCCc1cnc(-c2ccc(OCCCCCCCC[Si](C)(C)C[Si](C)(C)C)cc2)nc1 |
| InChI | InChI=1S/C32H56N2OSi2/c1-7-8-9-10-13-16-19-29-26-33-32(34-27-29)30-20-22-31(23-21-30)35-24-17-14-11-12-15-18-25-37(5,6)28-36(2,3)4/h20-23,26-27H,7-19,24-25,28H2,1-6H3 |
| InChIKey | IUXNYHYMTCQUDH-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.99 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|