C25H40F3NO3 — CID 161362380
ethyl acetate;2-methyl-4-[4-(10,10,10-trifluorodecyl)phenyl]butanamide (PubChem CID 161362380) has the molecular formula C25H40F3NO3 and a molecular weight of 459.59 g/mol. Its IUPAC name is ethyl acetate;2-methyl-4-[4-(10,10,10-trifluorodecyl)phenyl]butanamide.
| Compound Name | ethyl acetate;2-methyl-4-[4-(10,10,10-trifluorodecyl)phenyl]butanamide |
|---|---|
| PubChem CID | 161362380 |
| Molecular Formula | C25H40F3NO3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | ethyl acetate;2-methyl-4-[4-(10,10,10-trifluorodecyl)phenyl]butanamide |
| SMILES | CC(CCc1ccc(CCCCCCCCCC(F)(F)F)cc1)C(N)=O.CCOC(C)=O |
| InChI | InChI=1S/C21H32F3NO.C4H8O2/c1-17(20(25)26)10-11-19-14-12-18(13-15-19)9-7-5-3-2-4-6-8-16-21(22,23)24;1-3-6-4(2)5/h12-15,17H,2-11,16H2,1H3,(H2,25,26);3H2,1-2H3 |
| InChIKey | VPIVZSVHCGWTHM-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|