C18H18F3NO — CID 157198688
(2R)-2-methyl-4-[4-[4-(trifluoromethyl)phenyl]phenyl]butanamide (PubChem CID 157198688) has the molecular formula C18H18F3NO and a molecular weight of 321.34 g/mol. Its IUPAC name is (2R)-2-methyl-4-[4-[4-(trifluoromethyl)phenyl]phenyl]butanamide.
| Compound Name | (2R)-2-methyl-4-[4-[4-(trifluoromethyl)phenyl]phenyl]butanamide |
|---|---|
| PubChem CID | 157198688 |
| Molecular Formula | C18H18F3NO |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (2R)-2-methyl-4-[4-[4-(trifluoromethyl)phenyl]phenyl]butanamide |
| SMILES | C[C@H](CCc1ccc(-c2ccc(C(F)(F)F)cc2)cc1)C(N)=O |
| InChI | InChI=1S/C18H18F3NO/c1-12(17(22)23)2-3-13-4-6-14(7-5-13)15-8-10-16(11-9-15)18(19,20)21/h4-12H,2-3H2,1H3,(H2,22,23)/t12-/m1/s1 |
| InChIKey | AQNWLULAEDDSMP-GFCCVEGCSA-N |
| XLogP | 4.43 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |