C21H24ClF3N2O — CID 168861912
(2S)-2-amino-N-chloro-N-[2-[4-[4-(trifluoromethyl)phenyl]phenyl]ethyl]hexanamide (PubChem CID 168861912) has the molecular formula C21H24ClF3N2O and a molecular weight of 412.88 g/mol. Its IUPAC name is (2S)-2-amino-N-chloro-N-[2-[4-[4-(trifluoromethyl)phenyl]phenyl]ethyl]hexanamide.
| Compound Name | (2S)-2-amino-N-chloro-N-[2-[4-[4-(trifluoromethyl)phenyl]phenyl]ethyl]hexanamide |
|---|---|
| PubChem CID | 168861912 |
| Molecular Formula | C21H24ClF3N2O |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (2S)-2-amino-N-chloro-N-[2-[4-[4-(trifluoromethyl)phenyl]phenyl]ethyl]hexanamide |
| SMILES | CCCC[C@H](N)C(=O)N(Cl)CCc1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H24ClF3N2O/c1-2-3-4-19(26)20(28)27(22)14-13-15-5-7-16(8-6-15)17-9-11-18(12-10-17)21(23,24)25/h5-12,19H,2-4,13-14,26H2,1H3/t19-/m0/s1 |
| InChIKey | NKNXTASDHRVSII-IBGZPJMESA-N |
| XLogP | 5.41 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|