C33H41F3N2O2 — CID 158980737
2-amino-N-(4-decoxyphenyl)-2-phenyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide (PubChem CID 158980737) has the molecular formula C33H41F3N2O2 and a molecular weight of 554.70 g/mol. Its IUPAC name is 2-amino-N-(4-decoxyphenyl)-2-phenyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide.
| Compound Name | 2-amino-N-(4-decoxyphenyl)-2-phenyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 158980737 |
| Molecular Formula | C33H41F3N2O2 |
| Molecular Weight | 554.70 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | 2-amino-N-(4-decoxyphenyl)-2-phenyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide |
| SMILES | CCCCCCCCCCOc1ccc(N(CCc2ccc(C(F)(F)F)cc2)C(=O)C(N)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H41F3N2O2/c1-2-3-4-5-6-7-8-12-25-40-30-21-19-29(20-22-30)38(32(39)31(37)27-13-10-9-11-14-27)24-23-26-15-17-28(18-16-26)33(34,35)36/h9-11,13-22,31H,2-8,12,23-25,37H2,1H3 |
| InChIKey | QPOKDRRCYNYVLM-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.70 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|