C25H29F3N2O — CID 143753245
(E)-2-amino-N-(4-methylphenyl)-3-[(Z)-prop-1-enyl]-N-[2-[4-(trifluoromethyl)phenyl]ethyl]hex-3-enamide (PubChem CID 143753245) has the molecular formula C25H29F3N2O and a molecular weight of 430.51 g/mol. Its IUPAC name is (E)-2-amino-N-(4-methylphenyl)-3-[(Z)-prop-1-enyl]-N-[2-[4-(trifluoromethyl)phenyl]ethyl]hex-3-enamide.
| Compound Name | (E)-2-amino-N-(4-methylphenyl)-3-[(Z)-prop-1-enyl]-N-[2-[4-(trifluoromethyl)phenyl]ethyl]hex-3-enamide |
|---|---|
| PubChem CID | 143753245 |
| Molecular Formula | C25H29F3N2O |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (E)-2-amino-N-(4-methylphenyl)-3-[(Z)-prop-1-enyl]-N-[2-[4-(trifluoromethyl)phenyl]ethyl]hex-3-enamide |
| SMILES | C/C=C\C(=C/CC)C(N)C(=O)N(CCc1ccc(C(F)(F)F)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H29F3N2O/c1-4-6-20(7-5-2)23(29)24(31)30(22-14-8-18(3)9-15-22)17-16-19-10-12-21(13-11-19)25(26,27)28/h4,6-15,23H,5,16-17,29H2,1-3H3/b6-4-,20-7+ |
| InChIKey | MAGXHJKBDJYYGI-IIZGQCKHSA-N |
| XLogP | 5.83 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|