C26H27F3N2O — CID 69039769
N-methyl-2-[4-methyl-N-[3-[4-(trifluoromethyl)phenyl]propyl]anilino]-2-phenylacetamide (PubChem CID 69039769) has the molecular formula C26H27F3N2O and a molecular weight of 440.51 g/mol. Its IUPAC name is N-methyl-2-[4-methyl-N-[3-[4-(trifluoromethyl)phenyl]propyl]anilino]-2-phenylacetamide.
| Compound Name | N-methyl-2-[4-methyl-N-[3-[4-(trifluoromethyl)phenyl]propyl]anilino]-2-phenylacetamide |
|---|---|
| PubChem CID | 69039769 |
| Molecular Formula | C26H27F3N2O |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | N-methyl-2-[4-methyl-N-[3-[4-(trifluoromethyl)phenyl]propyl]anilino]-2-phenylacetamide |
| SMILES | CNC(=O)C(c1ccccc1)N(CCCc1ccc(C(F)(F)F)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H27F3N2O/c1-19-10-16-23(17-11-19)31(24(25(32)30-2)21-8-4-3-5-9-21)18-6-7-20-12-14-22(15-13-20)26(27,28)29/h3-5,8-17,24H,6-7,18H2,1-2H3,(H,30,32) |
| InChIKey | JUNBMIWCAKLQEW-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|