C27H28F4N2O3 — CID 69043156
(2R)-2-[3,4-dimethoxy-N-[3-[4-(trifluoromethyl)phenyl]propyl]anilino]-2-(4-fluorophenyl)-N-methylacetamide (PubChem CID 69043156) has the molecular formula C27H28F4N2O3 and a molecular weight of 504.52 g/mol. Its IUPAC name is (2R)-2-[3,4-dimethoxy-N-[3-[4-(trifluoromethyl)phenyl]propyl]anilino]-2-(4-fluorophenyl)-N-methylacetamide.
| Compound Name | (2R)-2-[3,4-dimethoxy-N-[3-[4-(trifluoromethyl)phenyl]propyl]anilino]-2-(4-fluorophenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 69043156 |
| Molecular Formula | C27H28F4N2O3 |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | (2R)-2-[3,4-dimethoxy-N-[3-[4-(trifluoromethyl)phenyl]propyl]anilino]-2-(4-fluorophenyl)-N-methylacetamide |
| SMILES | CNC(=O)[C@@H](c1ccc(F)cc1)N(CCCc1ccc(C(F)(F)F)cc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C27H28F4N2O3/c1-32-26(34)25(19-8-12-21(28)13-9-19)33(22-14-15-23(35-2)24(17-22)36-3)16-4-5-18-6-10-20(11-7-18)27(29,30)31/h6-15,17,25H,4-5,16H2,1-3H3,(H,32,34)/t25-/m1/s1 |
| InChIKey | MGFWOLWSFGPCTA-RUZDIDTESA-N |
| XLogP | 5.79 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|