C26H28F3N3O3 — CID 69041629
(2R)-2-[3,4-dimethoxy-N-[3-[6-(trifluoromethyl)-3-pyridinyl]propyl]anilino]-N-methyl-2-phenylacetamide (PubChem CID 69041629) has the molecular formula C26H28F3N3O3 and a molecular weight of 487.52 g/mol. Its IUPAC name is (2R)-2-[3,4-dimethoxy-N-[3-[6-(trifluoromethyl)-3-pyridinyl]propyl]anilino]-N-methyl-2-phenylacetamide.
| Compound Name | (2R)-2-[3,4-dimethoxy-N-[3-[6-(trifluoromethyl)-3-pyridinyl]propyl]anilino]-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 69041629 |
| Molecular Formula | C26H28F3N3O3 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | (2R)-2-[3,4-dimethoxy-N-[3-[6-(trifluoromethyl)-3-pyridinyl]propyl]anilino]-N-methyl-2-phenylacetamide |
| SMILES | CNC(=O)[C@@H](c1ccccc1)N(CCCc1ccc(C(F)(F)F)nc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C26H28F3N3O3/c1-30-25(33)24(19-9-5-4-6-10-19)32(20-12-13-21(34-2)22(16-20)35-3)15-7-8-18-11-14-23(31-17-18)26(27,28)29/h4-6,9-14,16-17,24H,7-8,15H2,1-3H3,(H,30,33)/t24-/m1/s1 |
| InChIKey | MWNHXGAFTQOXQR-XMMPIXPASA-N |
| XLogP | 5.04 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|