C26H30N2O4 — CID 69042296
(2R)-2-[N-[3-(2-hydroxyphenyl)propyl]-3,4-dimethoxyanilino]-N-methyl-2-phenylacetamide (PubChem CID 69042296) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is (2R)-2-[N-[3-(2-hydroxyphenyl)propyl]-3,4-dimethoxyanilino]-N-methyl-2-phenylacetamide.
| Compound Name | (2R)-2-[N-[3-(2-hydroxyphenyl)propyl]-3,4-dimethoxyanilino]-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 69042296 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (2R)-2-[N-[3-(2-hydroxyphenyl)propyl]-3,4-dimethoxyanilino]-N-methyl-2-phenylacetamide |
| SMILES | CNC(=O)[C@@H](c1ccccc1)N(CCCc1ccccc1O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C26H30N2O4/c1-27-26(30)25(20-11-5-4-6-12-20)28(17-9-13-19-10-7-8-14-22(19)29)21-15-16-23(31-2)24(18-21)32-3/h4-8,10-12,14-16,18,25,29H,9,13,17H2,1-3H3,(H,27,30)/t25-/m1/s1 |
| InChIKey | CTVZQXCXWYVSHA-RUZDIDTESA-N |
| XLogP | 4.34 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|