C27H29F3N2O — CID 69041685
2-[3,4-dimethyl-N-[3-[4-(trifluoromethyl)phenyl]propyl]anilino]-N-methyl-2-phenylacetamide (PubChem CID 69041685) has the molecular formula C27H29F3N2O and a molecular weight of 454.54 g/mol. Its IUPAC name is 2-[3,4-dimethyl-N-[3-[4-(trifluoromethyl)phenyl]propyl]anilino]-N-methyl-2-phenylacetamide.
| Compound Name | 2-[3,4-dimethyl-N-[3-[4-(trifluoromethyl)phenyl]propyl]anilino]-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 69041685 |
| Molecular Formula | C27H29F3N2O |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 2-[3,4-dimethyl-N-[3-[4-(trifluoromethyl)phenyl]propyl]anilino]-N-methyl-2-phenylacetamide |
| SMILES | CNC(=O)C(c1ccccc1)N(CCCc1ccc(C(F)(F)F)cc1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C27H29F3N2O/c1-19-11-16-24(18-20(19)2)32(25(26(33)31-3)22-9-5-4-6-10-22)17-7-8-21-12-14-23(15-13-21)27(28,29)30/h4-6,9-16,18,25H,7-8,17H2,1-3H3,(H,31,33) |
| InChIKey | XSSJWAGTIYRTKF-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|