C21H25F3N2O — CID 162721267
2-amino-N-[2-[4-[4-(trifluoromethyl)phenyl]phenyl]ethyl]hexanamide (PubChem CID 162721267) has the molecular formula C21H25F3N2O and a molecular weight of 378.44 g/mol. Its IUPAC name is 2-amino-N-[2-[4-[4-(trifluoromethyl)phenyl]phenyl]ethyl]hexanamide.
| Compound Name | 2-amino-N-[2-[4-[4-(trifluoromethyl)phenyl]phenyl]ethyl]hexanamide |
|---|---|
| PubChem CID | 162721267 |
| Molecular Formula | C21H25F3N2O |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2-amino-N-[2-[4-[4-(trifluoromethyl)phenyl]phenyl]ethyl]hexanamide |
| SMILES | CCCCC(N)C(=O)NCCc1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H25F3N2O/c1-2-3-4-19(25)20(27)26-14-13-15-5-7-16(8-6-15)17-9-11-18(12-10-17)21(22,23)24/h5-12,19H,2-4,13-14,25H2,1H3,(H,26,27) |
| InChIKey | FBJWRXBECXKOBG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |