C12H15F3O — CID 64666701
2-methyl-4-[4-(trifluoromethyl)phenyl]butan-1-ol (PubChem CID 64666701) has the molecular formula C12H15F3O and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-methyl-4-[4-(trifluoromethyl)phenyl]butan-1-ol.
| Compound Name | 2-methyl-4-[4-(trifluoromethyl)phenyl]butan-1-ol |
|---|---|
| PubChem CID | 64666701 |
| Molecular Formula | C12H15F3O |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 2-methyl-4-[4-(trifluoromethyl)phenyl]butan-1-ol |
| SMILES | CC(CO)CCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3O/c1-9(8-16)2-3-10-4-6-11(7-5-10)12(13,14)15/h4-7,9,16H,2-3,8H2,1H3 |
| InChIKey | BTEKRVBABPQUGR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |