C26H45NO4Si — CID 139768282
diethyl 2-amino-2-[2-[4-[5-[butyl(dimethyl)silyl]pentyl]phenyl]ethyl]propanedioate (PubChem CID 139768282) has the molecular formula C26H45NO4Si and a molecular weight of 463.74 g/mol. Its IUPAC name is diethyl 2-amino-2-[2-[4-[5-[butyl(dimethyl)silyl]pentyl]phenyl]ethyl]propanedioate.
| Compound Name | diethyl 2-amino-2-[2-[4-[5-[butyl(dimethyl)silyl]pentyl]phenyl]ethyl]propanedioate |
|---|---|
| PubChem CID | 139768282 |
| Molecular Formula | C26H45NO4Si |
| Molecular Weight | 463.74 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | diethyl 2-amino-2-[2-[4-[5-[butyl(dimethyl)silyl]pentyl]phenyl]ethyl]propanedioate |
| SMILES | CCCC[Si](C)(C)CCCCCc1ccc(CCC(N)(C(=O)OCC)C(=O)OCC)cc1 |
| InChI | InChI=1S/C26H45NO4Si/c1-6-9-20-32(4,5)21-12-10-11-13-22-14-16-23(17-15-22)18-19-26(27,24(28)30-7-2)25(29)31-8-3/h14-17H,6-13,18-21,27H2,1-5H3 |
| InChIKey | HTAWMHRFIAQIDX-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.74 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|