C28H40O4Si — CID 139768120
diethyl 2-[2-[4-[4-[benzyl(dimethyl)silyl]butyl]phenyl]ethyl]propanedioate (PubChem CID 139768120) has the molecular formula C28H40O4Si and a molecular weight of 468.71 g/mol. Its IUPAC name is diethyl 2-[2-[4-[4-[benzyl(dimethyl)silyl]butyl]phenyl]ethyl]propanedioate.
| Compound Name | diethyl 2-[2-[4-[4-[benzyl(dimethyl)silyl]butyl]phenyl]ethyl]propanedioate |
|---|---|
| PubChem CID | 139768120 |
| Molecular Formula | C28H40O4Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | diethyl 2-[2-[4-[4-[benzyl(dimethyl)silyl]butyl]phenyl]ethyl]propanedioate |
| SMILES | CCOC(=O)C(CCc1ccc(CCCC[Si](C)(C)Cc2ccccc2)cc1)C(=O)OCC |
| InChI | InChI=1S/C28H40O4Si/c1-5-31-27(29)26(28(30)32-6-2)20-19-24-17-15-23(16-18-24)12-10-11-21-33(3,4)22-25-13-8-7-9-14-25/h7-9,13-18,26H,5-6,10-12,19-22H2,1-4H3 |
| InChIKey | DMWRSCICTBCEFI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|