About benzenecarbodithioic acid;diethyl 2-(2-phenylethyl)propanedioate
benzenecarbodithioic acid;diethyl 2-(2-phenylethyl)propanedioate (PubChem CID 175282193) has the molecular formula C22H26O4S2
and a molecular weight of 418.58 g/mol. Its IUPAC name is benzenecarbodithioic acid;diethyl 2-(2-phenylethyl)propanedioate.
Molecular Properties
| Compound Name | benzenecarbodithioic acid;diethyl 2-(2-phenylethyl)propanedioate |
| PubChem CID | 175282193 |
| Molecular Formula | C22H26O4S2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | benzenecarbodithioic acid;diethyl 2-(2-phenylethyl)propanedioate |
| SMILES | CCOC(=O)C(CCc1ccccc1)C(=O)OCC.S=C(S)c1ccccc1 |
| InChI | InChI=1S/C15H20O4.C7H6S2/c1-3-18-14(16)13(15(17)19-4-2)11-10-12-8-6-5-7-9-12;8-7(9)6-4-2-1-3-5-6/h5-9,13H,3-4,10-11H2,1-2H3;1-5H,(H,8,9) |
| InChIKey | PVJIQABGHUPJRY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze benzenecarbodithioic acid;diethyl 2-(2-phenylethyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenecarbodithioic acid;diethyl 2-(2-phenylethyl)propanedioate?
The IUPAC name of benzenecarbodithioic acid;diethyl 2-(2-phenylethyl)propanedioate (CID 175282193) is benzenecarbodithioic acid;diethyl 2-(2-phenylethyl)propanedioate.
What is the SMILES notation for benzenecarbodithioic acid;diethyl 2-(2-phenylethyl)propanedioate?
The canonical SMILES for benzenecarbodithioic acid;diethyl 2-(2-phenylethyl)propanedioate is CCOC(=O)C(CCc1ccccc1)C(=O)OCC.S=C(S)c1ccccc1.
What is the InChIKey of benzenecarbodithioic acid;diethyl 2-(2-phenylethyl)propanedioate?
The InChIKey is PVJIQABGHUPJRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O4.C7H6S2/c1-3-18-14(16)13(15(17)19-4-2)11-10-12-8-6-5-7-9-12;8-7(9)6-4-2-1-3-5-6/h5-9,13H,3-4,10-11H2,1-2H3;1-5H,(H,8,9).
What are the key properties of benzenecarbodithioic acid;diethyl 2-(2-phenylethyl)propanedioate?
benzenecarbodithioic acid;diethyl 2-(2-phenylethyl)propanedioate has a molecular weight of 418.58 g/mol, XLogP of 4.65, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzenecarbodithioic acid;diethyl 2-(2-phenylethyl)propanedioate is sourced from PubChem (CID 175282193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).