C29H37NOSi — CID 70578721
2-amino-8-[benzyl(dimethyl)silyl]-1,3-diphenyloctan-4-one (PubChem CID 70578721) has the molecular formula C29H37NOSi and a molecular weight of 443.71 g/mol. Its IUPAC name is 2-amino-8-[benzyl(dimethyl)silyl]-1,3-diphenyloctan-4-one.
| Compound Name | 2-amino-8-[benzyl(dimethyl)silyl]-1,3-diphenyloctan-4-one |
|---|---|
| PubChem CID | 70578721 |
| Molecular Formula | C29H37NOSi |
| Molecular Weight | 443.71 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 2-amino-8-[benzyl(dimethyl)silyl]-1,3-diphenyloctan-4-one |
| SMILES | C[Si](C)(CCCCC(=O)C(c1ccccc1)C(N)Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H37NOSi/c1-32(2,23-25-16-8-4-9-17-25)21-13-12-20-28(31)29(26-18-10-5-11-19-26)27(30)22-24-14-6-3-7-15-24/h3-11,14-19,27,29H,12-13,20-23,30H2,1-2H3 |
| InChIKey | DNDXSSCSJXBTCF-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.71 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|