C24H35NO3Si — CID 139768131
2-amino-2-[2-[4-[3-(1-phenylsilolan-1-yl)propoxy]phenyl]ethyl]propane-1,3-diol (PubChem CID 139768131) has the molecular formula C24H35NO3Si and a molecular weight of 413.63 g/mol. Its IUPAC name is 2-amino-2-[2-[4-[3-(1-phenylsilolan-1-yl)propoxy]phenyl]ethyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[2-[4-[3-(1-phenylsilolan-1-yl)propoxy]phenyl]ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 139768131 |
| Molecular Formula | C24H35NO3Si |
| Molecular Weight | 413.63 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 2-amino-2-[2-[4-[3-(1-phenylsilolan-1-yl)propoxy]phenyl]ethyl]propane-1,3-diol |
| SMILES | NC(CO)(CO)CCc1ccc(OCCC[Si]2(c3ccccc3)CCCC2)cc1 |
| InChI | InChI=1S/C24H35NO3Si/c25-24(19-26,20-27)14-13-21-9-11-22(12-10-21)28-15-6-18-29(16-4-5-17-29)23-7-2-1-3-8-23/h1-3,7-12,26-27H,4-6,13-20,25H2 |
| InChIKey | YUWVLDKTZYKADE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.63 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|