C23H36ClNO4Si — CID 139768133
2-amino-2-[2-[4-[3-[(3-methoxyphenyl)-dimethylsilyl]propoxy]phenyl]ethyl]propane-1,3-diol;hydrochloride (PubChem CID 139768133) has the molecular formula C23H36ClNO4Si and a molecular weight of 454.08 g/mol. Its IUPAC name is 2-amino-2-[2-[4-[3-[(3-methoxyphenyl)-dimethylsilyl]propoxy]phenyl]ethyl]propane-1,3-diol;hydrochloride.
| Compound Name | 2-amino-2-[2-[4-[3-[(3-methoxyphenyl)-dimethylsilyl]propoxy]phenyl]ethyl]propane-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 139768133 |
| Molecular Formula | C23H36ClNO4Si |
| Molecular Weight | 454.08 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 2-amino-2-[2-[4-[3-[(3-methoxyphenyl)-dimethylsilyl]propoxy]phenyl]ethyl]propane-1,3-diol;hydrochloride |
| SMILES | COc1cccc([Si](C)(C)CCCOc2ccc(CCC(N)(CO)CO)cc2)c1.Cl |
| InChI | InChI=1S/C23H35NO4Si.ClH/c1-27-21-6-4-7-22(16-21)29(2,3)15-5-14-28-20-10-8-19(9-11-20)12-13-23(24,17-25)18-26;/h4,6-11,16,25-26H,5,12-15,17-18,24H2,1-3H3;1H |
| InChIKey | UZQQDMALRCUICQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.08 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|