C16H23ClF5NO2 — CID 86606737
(2R)-2-amino-2-methyl-4-[4-(4,4,5,5,5-pentafluoropentoxy)phenyl]butan-1-ol;hydrochloride (PubChem CID 86606737) has the molecular formula C16H23ClF5NO2 and a molecular weight of 391.81 g/mol. Its IUPAC name is (2R)-2-amino-2-methyl-4-[4-(4,4,5,5,5-pentafluoropentoxy)phenyl]butan-1-ol;hydrochloride.
| Compound Name | (2R)-2-amino-2-methyl-4-[4-(4,4,5,5,5-pentafluoropentoxy)phenyl]butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 86606737 |
| Molecular Formula | C16H23ClF5NO2 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | (2R)-2-amino-2-methyl-4-[4-(4,4,5,5,5-pentafluoropentoxy)phenyl]butan-1-ol;hydrochloride |
| SMILES | C[C@](N)(CO)CCc1ccc(OCCCC(F)(F)C(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C16H22F5NO2.ClH/c1-14(22,11-23)9-7-12-3-5-13(6-4-12)24-10-2-8-15(17,18)16(19,20)21;/h3-6,23H,2,7-11,22H2,1H3;1H/t14-;/m1./s1 |
| InChIKey | BZHUDNXPTGEPLF-PFEQFJNWSA-N |
| XLogP | 4.11 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|