C28H33NO8S — CID 71204388
diethyl 2-acetamido-2-[2-[4-[4-(2-propanoyloxyacetyl)phenyl]sulfanylphenyl]ethyl]propanedioate (PubChem CID 71204388) has the molecular formula C28H33NO8S and a molecular weight of 543.64 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[2-[4-[4-(2-propanoyloxyacetyl)phenyl]sulfanylphenyl]ethyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[2-[4-[4-(2-propanoyloxyacetyl)phenyl]sulfanylphenyl]ethyl]propanedioate |
|---|---|
| PubChem CID | 71204388 |
| Molecular Formula | C28H33NO8S |
| Molecular Weight | 543.64 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | diethyl 2-acetamido-2-[2-[4-[4-(2-propanoyloxyacetyl)phenyl]sulfanylphenyl]ethyl]propanedioate |
| SMILES | CCOC(=O)C(CCc1ccc(Sc2ccc(C(=O)COC(=O)CC)cc2)cc1)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C28H33NO8S/c1-5-25(32)37-18-24(31)21-10-14-23(15-11-21)38-22-12-8-20(9-13-22)16-17-28(29-19(4)30,26(33)35-6-2)27(34)36-7-3/h8-15H,5-7,16-18H2,1-4H3,(H,29,30) |
| InChIKey | UGYTWGUQJGZEDU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.64 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|