C21H25NO5 — CID 10339197
diethyl 2-acetamido-2-[(6-methylnaphthalen-2-yl)methyl]propanedioate (PubChem CID 10339197) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[(6-methylnaphthalen-2-yl)methyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[(6-methylnaphthalen-2-yl)methyl]propanedioate |
|---|---|
| PubChem CID | 10339197 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | diethyl 2-acetamido-2-[(6-methylnaphthalen-2-yl)methyl]propanedioate |
| SMILES | CCOC(=O)C(Cc1ccc2cc(C)ccc2c1)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C21H25NO5/c1-5-26-19(24)21(22-15(4)23,20(25)27-6-2)13-16-8-10-17-11-14(3)7-9-18(17)12-16/h7-12H,5-6,13H2,1-4H3,(H,22,23) |
| InChIKey | AVEDJBJUQADBKI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|