C20H25BrN2O5 — CID 56595568
diethyl 2-acetamido-2-[[5-(bromomethyl)-2-(2-cyanoethyl)phenyl]methyl]propanedioate (PubChem CID 56595568) has the molecular formula C20H25BrN2O5 and a molecular weight of 453.33 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[[5-(bromomethyl)-2-(2-cyanoethyl)phenyl]methyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[[5-(bromomethyl)-2-(2-cyanoethyl)phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 56595568 |
| Molecular Formula | C20H25BrN2O5 |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | diethyl 2-acetamido-2-[[5-(bromomethyl)-2-(2-cyanoethyl)phenyl]methyl]propanedioate |
| SMILES | CCOC(=O)C(Cc1cc(CBr)ccc1CCC#N)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C20H25BrN2O5/c1-4-27-18(25)20(23-14(3)24,19(26)28-5-2)12-17-11-15(13-21)8-9-16(17)7-6-10-22/h8-9,11H,4-7,12-13H2,1-3H3,(H,23,24) |
| InChIKey | UWJLRYPUERZBIV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|