C23H36NO8P — CID 70442105
[1-[2-(2-acetamido-3-ethoxy-2-ethoxycarbonyl-3-oxopropyl)phenyl]-3-ethylpentan-3-yl]phosphonic acid (PubChem CID 70442105) has the molecular formula C23H36NO8P and a molecular weight of 485.51 g/mol. Its IUPAC name is [1-[2-(2-acetamido-3-ethoxy-2-ethoxycarbonyl-3-oxopropyl)phenyl]-3-ethylpentan-3-yl]phosphonic acid.
| Compound Name | [1-[2-(2-acetamido-3-ethoxy-2-ethoxycarbonyl-3-oxopropyl)phenyl]-3-ethylpentan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 70442105 |
| Molecular Formula | C23H36NO8P |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | [1-[2-(2-acetamido-3-ethoxy-2-ethoxycarbonyl-3-oxopropyl)phenyl]-3-ethylpentan-3-yl]phosphonic acid |
| SMILES | CCOC(=O)C(Cc1ccccc1CCC(CC)(CC)P(=O)(O)O)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C23H36NO8P/c1-6-22(7-2,33(28,29)30)15-14-18-12-10-11-13-19(18)16-23(24-17(5)25,20(26)31-8-3)21(27)32-9-4/h10-13H,6-9,14-16H2,1-5H3,(H,24,25)(H2,28,29,30) |
| InChIKey | SJFAHKWELJPPFF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|