C19H25NO5 — CID 102185149
diethyl 2-acetamido-2-[(Z)-3-phenylbut-2-enyl]propanedioate (PubChem CID 102185149) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[(Z)-3-phenylbut-2-enyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[(Z)-3-phenylbut-2-enyl]propanedioate |
|---|---|
| PubChem CID | 102185149 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | diethyl 2-acetamido-2-[(Z)-3-phenylbut-2-enyl]propanedioate |
| SMILES | CCOC(=O)C(C/C=C(/C)c1ccccc1)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C19H25NO5/c1-5-24-17(22)19(20-15(4)21,18(23)25-6-2)13-12-14(3)16-10-8-7-9-11-16/h7-12H,5-6,13H2,1-4H3,(H,20,21)/b14-12- |
| InChIKey | ACSJYKFFPNHDIF-OWBHPGMISA-N |
| XLogP | 2.48 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|