C18H20F3NO6 — CID 23201589
diethyl 2-acetamido-2-[2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl]propanedioate (PubChem CID 23201589) has the molecular formula C18H20F3NO6 and a molecular weight of 403.35 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl]propanedioate |
|---|---|
| PubChem CID | 23201589 |
| Molecular Formula | C18H20F3NO6 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | diethyl 2-acetamido-2-[2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl]propanedioate |
| SMILES | CCOC(=O)C(CC(=O)c1cccc(C(F)(F)F)c1)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C18H20F3NO6/c1-4-27-15(25)17(22-11(3)23,16(26)28-5-2)10-14(24)12-7-6-8-13(9-12)18(19,20)21/h6-9H,4-5,10H2,1-3H3,(H,22,23) |
| InChIKey | TVJGNFZVPOFKEW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|