C18H23NO6 — CID 23201587
diethyl 2-acetamido-2-[2-(2-methylphenyl)-2-oxoethyl]propanedioate (PubChem CID 23201587) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[2-(2-methylphenyl)-2-oxoethyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[2-(2-methylphenyl)-2-oxoethyl]propanedioate |
|---|---|
| PubChem CID | 23201587 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | diethyl 2-acetamido-2-[2-(2-methylphenyl)-2-oxoethyl]propanedioate |
| SMILES | CCOC(=O)C(CC(=O)c1ccccc1C)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C18H23NO6/c1-5-24-16(22)18(19-13(4)20,17(23)25-6-2)11-15(21)14-10-8-7-9-12(14)3/h7-10H,5-6,11H2,1-4H3,(H,19,20) |
| InChIKey | LOINGKATNSPIRJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|