C16H20INO5 — CID 71356886
diethyl 2-acetamido-2-[(2-iodophenyl)methyl]propanedioate (PubChem CID 71356886) has the molecular formula C16H20INO5 and a molecular weight of 433.24 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[(2-iodophenyl)methyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[(2-iodophenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 71356886 |
| Molecular Formula | C16H20INO5 |
| Molecular Weight | 433.24 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | diethyl 2-acetamido-2-[(2-iodophenyl)methyl]propanedioate |
| SMILES | CCOC(=O)C(Cc1ccccc1I)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C16H20INO5/c1-4-22-14(20)16(18-11(3)19,15(21)23-5-2)10-12-8-6-7-9-13(12)17/h6-9H,4-5,10H2,1-3H3,(H,18,19) |
| InChIKey | OKFUHFNCRMGJHJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|