C23H24N2O6 — CID 154287399
2-acetamido-3-ethoxy-3-oxo-2-[(5-phenylmethoxy-1H-indol-3-yl)methyl]propanoic acid (PubChem CID 154287399) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is 2-acetamido-3-ethoxy-3-oxo-2-[(5-phenylmethoxy-1H-indol-3-yl)methyl]propanoic acid.
| Compound Name | 2-acetamido-3-ethoxy-3-oxo-2-[(5-phenylmethoxy-1H-indol-3-yl)methyl]propanoic acid |
|---|---|
| PubChem CID | 154287399 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-acetamido-3-ethoxy-3-oxo-2-[(5-phenylmethoxy-1H-indol-3-yl)methyl]propanoic acid |
| SMILES | CCOC(=O)C(Cc1c[nH]c2ccc(OCc3ccccc3)cc12)(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C23H24N2O6/c1-3-30-22(29)23(21(27)28,25-15(2)26)12-17-13-24-20-10-9-18(11-19(17)20)31-14-16-7-5-4-6-8-16/h4-11,13,24H,3,12,14H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | GZXJKUHBWTXJFX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|