C16H19Cl2NO5 — CID 11749205
diethyl 2-acetamido-2-[(2,6-dichlorophenyl)methyl]propanedioate (PubChem CID 11749205) has the molecular formula C16H19Cl2NO5 and a molecular weight of 376.24 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[(2,6-dichlorophenyl)methyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[(2,6-dichlorophenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 11749205 |
| Molecular Formula | C16H19Cl2NO5 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | diethyl 2-acetamido-2-[(2,6-dichlorophenyl)methyl]propanedioate |
| SMILES | CCOC(=O)C(Cc1c(Cl)cccc1Cl)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C16H19Cl2NO5/c1-4-23-14(21)16(19-10(3)20,15(22)24-5-2)9-11-12(17)7-6-8-13(11)18/h6-8H,4-5,9H2,1-3H3,(H,19,20) |
| InChIKey | ZKDQQBGKSOYYNG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|