C15H15N2O5- — CID 22747914
2-acetamido-2-[(3-cyanophenyl)methyl]-3-ethoxy-3-oxopropanoate (PubChem CID 22747914) has the molecular formula C15H15N2O5- and a molecular weight of 303.29 g/mol. Its IUPAC name is 2-acetamido-2-[(3-cyanophenyl)methyl]-3-ethoxy-3-oxopropanoate.
| Compound Name | 2-acetamido-2-[(3-cyanophenyl)methyl]-3-ethoxy-3-oxopropanoate |
|---|---|
| PubChem CID | 22747914 |
| Molecular Formula | C15H15N2O5- |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-acetamido-2-[(3-cyanophenyl)methyl]-3-ethoxy-3-oxopropanoate |
| SMILES | CCOC(=O)C(Cc1cccc(C#N)c1)(NC(C)=O)C(=O)[O-] |
| InChI | InChI=1S/C15H16N2O5/c1-3-22-14(21)15(13(19)20,17-10(2)18)8-11-5-4-6-12(7-11)9-16/h4-7H,3,8H2,1-2H3,(H,17,18)(H,19,20)/p-1 |
| InChIKey | IIXSNWCNBAUMFP-UHFFFAOYSA-M |
| XLogP | -0.71 |
| TPSA | 119.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|