C14H16Cl2O4 — CID 103974448
2-[(2,6-dichlorophenyl)methyl]-2-ethoxycarbonylbutanoic acid (PubChem CID 103974448) has the molecular formula C14H16Cl2O4 and a molecular weight of 319.18 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methyl]-2-ethoxycarbonylbutanoic acid.
| Compound Name | 2-[(2,6-dichlorophenyl)methyl]-2-ethoxycarbonylbutanoic acid |
|---|---|
| PubChem CID | 103974448 |
| Molecular Formula | C14H16Cl2O4 |
| Molecular Weight | 319.18 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methyl]-2-ethoxycarbonylbutanoic acid |
| SMILES | CCOC(=O)C(CC)(Cc1c(Cl)cccc1Cl)C(=O)O |
| InChI | InChI=1S/C14H16Cl2O4/c1-3-14(12(17)18,13(19)20-4-2)8-9-10(15)6-5-7-11(9)16/h5-7H,3-4,8H2,1-2H3,(H,17,18) |
| InChIKey | BTSQIOXRUTXKTD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.18 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|