C20H29NO9 — CID 177386572
1-O,1-O-diethyl 7-O,7-O-dimethyl 1-acetamidoocta-3,4-diene-1,1,7,7-tetracarboxylate (PubChem CID 177386572) has the molecular formula C20H29NO9 and a molecular weight of 427.45 g/mol. Its IUPAC name is 1-O,1-O-diethyl 7-O,7-O-dimethyl 1-acetamidoocta-3,4-diene-1,1,7,7-tetracarboxylate.
| Compound Name | 1-O,1-O-diethyl 7-O,7-O-dimethyl 1-acetamidoocta-3,4-diene-1,1,7,7-tetracarboxylate |
|---|---|
| PubChem CID | 177386572 |
| Molecular Formula | C20H29NO9 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 1-O,1-O-diethyl 7-O,7-O-dimethyl 1-acetamidoocta-3,4-diene-1,1,7,7-tetracarboxylate |
| SMILES | CCOC(=O)C(CC=C=CCC(C)(C(=O)OC)C(=O)OC)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C20H29NO9/c1-7-29-17(25)20(21-14(3)22,18(26)30-8-2)13-11-9-10-12-19(4,15(23)27-5)16(24)28-6/h10-11H,7-8,12-13H2,1-6H3,(H,21,22) |
| InChIKey | CZIBOVYZCMSOEU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|