C16H28NO8P — CID 15415236
diethyl 2-acetamido-2-[(E)-3-diethoxyphosphorylprop-2-enyl]propanedioate (PubChem CID 15415236) has the molecular formula C16H28NO8P and a molecular weight of 393.37 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[(E)-3-diethoxyphosphorylprop-2-enyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[(E)-3-diethoxyphosphorylprop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 15415236 |
| Molecular Formula | C16H28NO8P |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | diethyl 2-acetamido-2-[(E)-3-diethoxyphosphorylprop-2-enyl]propanedioate |
| SMILES | CCOC(=O)C(C/C=C/P(=O)(OCC)OCC)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C16H28NO8P/c1-6-22-14(19)16(17-13(5)18,15(20)23-7-2)11-10-12-26(21,24-8-3)25-9-4/h10,12H,6-9,11H2,1-5H3,(H,17,18)/b12-10+ |
| InChIKey | XBYXRZXPIYPHTN-ZRDIBKRKSA-N |
| XLogP | 2.16 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|