C9H17O4P — CID 15453808
(1E,3E)-4-diethoxyphosphoryl-2-methylbuta-1,3-dien-1-ol (PubChem CID 15453808) has the molecular formula C9H17O4P and a molecular weight of 220.20 g/mol. Its IUPAC name is (1E,3E)-4-diethoxyphosphoryl-2-methylbuta-1,3-dien-1-ol.
| Compound Name | (1E,3E)-4-diethoxyphosphoryl-2-methylbuta-1,3-dien-1-ol |
|---|---|
| PubChem CID | 15453808 |
| Molecular Formula | C9H17O4P |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | (1E,3E)-4-diethoxyphosphoryl-2-methylbuta-1,3-dien-1-ol |
| SMILES | CCOP(=O)(/C=C/C(C)=C/O)OCC |
| InChI | InChI=1S/C9H17O4P/c1-4-12-14(11,13-5-2)7-6-9(3)8-10/h6-8,10H,4-5H2,1-3H3/b7-6+,9-8+ |
| InChIKey | XOCRWRQWLGQXAS-BLHCBFLLSA-N |
| XLogP | 3.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|