C11H21O3P — CID 139664435
(1E,3E)-1-diethoxyphosphoryl-3-ethylpenta-1,3-diene (PubChem CID 139664435) has the molecular formula C11H21O3P and a molecular weight of 232.26 g/mol. Its IUPAC name is (1E,3E)-1-diethoxyphosphoryl-3-ethylpenta-1,3-diene.
| Compound Name | (1E,3E)-1-diethoxyphosphoryl-3-ethylpenta-1,3-diene |
|---|---|
| PubChem CID | 139664435 |
| Molecular Formula | C11H21O3P |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (1E,3E)-1-diethoxyphosphoryl-3-ethylpenta-1,3-diene |
| SMILES | C/C=C(/C=C/P(=O)(OCC)OCC)CC |
| InChI | InChI=1S/C11H21O3P/c1-5-11(6-2)9-10-15(12,13-7-3)14-8-4/h5,9-10H,6-8H2,1-4H3/b10-9+,11-5+ |
| InChIKey | LZOLWDPSRNLVQO-PNGXCIJNSA-N |
| XLogP | 4.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|