About (1E,3E)-1-diethoxyphosphorylhexa-1,3-diene
(1E,3E)-1-diethoxyphosphorylhexa-1,3-diene (PubChem CID 13450210) has the molecular formula C10H19O3P
and a molecular weight of 218.23 g/mol. Its IUPAC name is (1E,3E)-1-diethoxyphosphorylhexa-1,3-diene.
Molecular Properties
| Compound Name | (1E,3E)-1-diethoxyphosphorylhexa-1,3-diene |
| PubChem CID | 13450210 |
| Molecular Formula | C10H19O3P |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (1E,3E)-1-diethoxyphosphorylhexa-1,3-diene |
| SMILES | CC/C=C/C=C/P(=O)(OCC)OCC |
| InChI | InChI=1S/C10H19O3P/c1-4-7-8-9-10-14(11,12-5-2)13-6-3/h7-10H,4-6H2,1-3H3/b8-7+,10-9+ |
| InChIKey | JJWHESZZODVMBW-XBLVEGMJSA-N |
| XLogP | 3.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E,3E)-1-diethoxyphosphorylhexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,3E)-1-diethoxyphosphorylhexa-1,3-diene?
The IUPAC name of (1E,3E)-1-diethoxyphosphorylhexa-1,3-diene (CID 13450210) is (1E,3E)-1-diethoxyphosphorylhexa-1,3-diene.
What is the SMILES notation for (1E,3E)-1-diethoxyphosphorylhexa-1,3-diene?
The canonical SMILES for (1E,3E)-1-diethoxyphosphorylhexa-1,3-diene is CC/C=C/C=C/P(=O)(OCC)OCC.
What is the InChIKey of (1E,3E)-1-diethoxyphosphorylhexa-1,3-diene?
The InChIKey is JJWHESZZODVMBW-XBLVEGMJSA-N. The full InChI is InChI=1S/C10H19O3P/c1-4-7-8-9-10-14(11,12-5-2)13-6-3/h7-10H,4-6H2,1-3H3/b8-7+,10-9+.
What are the key properties of (1E,3E)-1-diethoxyphosphorylhexa-1,3-diene?
(1E,3E)-1-diethoxyphosphorylhexa-1,3-diene has a molecular weight of 218.23 g/mol, XLogP of 3.73, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,3E)-1-diethoxyphosphorylhexa-1,3-diene is sourced from PubChem (CID 13450210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).