C22H41O3P — CID 135026457
(4Z,6E)-4-[(E)-2-diethoxyphosphorylethenyl]-5,6-dipropyldeca-4,6-diene (PubChem CID 135026457) has the molecular formula C22H41O3P and a molecular weight of 384.54 g/mol. Its IUPAC name is (4Z,6E)-4-[(E)-2-diethoxyphosphorylethenyl]-5,6-dipropyldeca-4,6-diene.
| Compound Name | (4Z,6E)-4-[(E)-2-diethoxyphosphorylethenyl]-5,6-dipropyldeca-4,6-diene |
|---|---|
| PubChem CID | 135026457 |
| Molecular Formula | C22H41O3P |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | (4Z,6E)-4-[(E)-2-diethoxyphosphorylethenyl]-5,6-dipropyldeca-4,6-diene |
| SMILES | CCC/C=C(CCC)/C(CCC)=C(\C=C\P(=O)(OCC)OCC)CCC |
| InChI | InChI=1S/C22H41O3P/c1-7-13-17-20(14-8-2)22(16-10-4)21(15-9-3)18-19-26(23,24-11-5)25-12-6/h17-19H,7-16H2,1-6H3/b19-18+,20-17+,22-21- |
| InChIKey | UAEJUPNZTRERGI-JFRCVXTASA-N |
| XLogP | 8.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|