C11H24NO3P — CID 101455726
(E)-1-diethoxyphosphoryl-N,N-dimethylpent-1-en-1-amine (PubChem CID 101455726) has the molecular formula C11H24NO3P and a molecular weight of 249.29 g/mol. Its IUPAC name is (E)-1-diethoxyphosphoryl-N,N-dimethylpent-1-en-1-amine.
| Compound Name | (E)-1-diethoxyphosphoryl-N,N-dimethylpent-1-en-1-amine |
|---|---|
| PubChem CID | 101455726 |
| Molecular Formula | C11H24NO3P |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (E)-1-diethoxyphosphoryl-N,N-dimethylpent-1-en-1-amine |
| SMILES | CCC/C=C(\N(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C11H24NO3P/c1-6-9-10-11(12(4)5)16(13,14-7-2)15-8-3/h10H,6-9H2,1-5H3/b11-10+ |
| InChIKey | WTPVKQWHOOHIRA-ZHACJKMWSA-N |
| XLogP | 3.46 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|