C12H24O6P2 — CID 23364349
2,3-bis(diethoxyphosphoryl)buta-1,3-diene (PubChem CID 23364349) has the molecular formula C12H24O6P2 and a molecular weight of 326.27 g/mol. Its IUPAC name is 2,3-bis(diethoxyphosphoryl)buta-1,3-diene.
| Compound Name | 2,3-bis(diethoxyphosphoryl)buta-1,3-diene |
|---|---|
| PubChem CID | 23364349 |
| Molecular Formula | C12H24O6P2 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2,3-bis(diethoxyphosphoryl)buta-1,3-diene |
| SMILES | C=C(C(=C)P(=O)(OCC)OCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C12H24O6P2/c1-7-15-19(13,16-8-2)11(5)12(6)20(14,17-9-3)18-10-4/h5-10H2,1-4H3 |
| InChIKey | OOUVWKWFPOODNY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|