About (Z)-1,2-dichloro-1-diethoxyphosphorylethene
(Z)-1,2-dichloro-1-diethoxyphosphorylethene (PubChem CID 12525125) has the molecular formula C6H11Cl2O3P
and a molecular weight of 233.03 g/mol. Its IUPAC name is (Z)-1,2-dichloro-1-diethoxyphosphorylethene.
Molecular Properties
| Compound Name | (Z)-1,2-dichloro-1-diethoxyphosphorylethene |
| PubChem CID | 12525125 |
| Molecular Formula | C6H11Cl2O3P |
| Molecular Weight | 233.03 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | (Z)-1,2-dichloro-1-diethoxyphosphorylethene |
| SMILES | CCOP(=O)(OCC)/C(Cl)=C/Cl |
| InChI | InChI=1S/C6H11Cl2O3P/c1-3-10-12(9,11-4-2)6(8)5-7/h5H,3-4H2,1-2H3/b6-5+ |
| InChIKey | VSCDEQKJARUAMJ-AATRIKPKSA-N |
| XLogP | 3.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.03 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,2-dichloro-1-diethoxyphosphorylethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,2-dichloro-1-diethoxyphosphorylethene?
The IUPAC name of (Z)-1,2-dichloro-1-diethoxyphosphorylethene (CID 12525125) is (Z)-1,2-dichloro-1-diethoxyphosphorylethene.
What is the SMILES notation for (Z)-1,2-dichloro-1-diethoxyphosphorylethene?
The canonical SMILES for (Z)-1,2-dichloro-1-diethoxyphosphorylethene is CCOP(=O)(OCC)/C(Cl)=C/Cl.
What is the InChIKey of (Z)-1,2-dichloro-1-diethoxyphosphorylethene?
The InChIKey is VSCDEQKJARUAMJ-AATRIKPKSA-N. The full InChI is InChI=1S/C6H11Cl2O3P/c1-3-10-12(9,11-4-2)6(8)5-7/h5H,3-4H2,1-2H3/b6-5+.
What are the key properties of (Z)-1,2-dichloro-1-diethoxyphosphorylethene?
(Z)-1,2-dichloro-1-diethoxyphosphorylethene has a molecular weight of 233.03 g/mol, XLogP of 3.53, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,2-dichloro-1-diethoxyphosphorylethene is sourced from PubChem (CID 12525125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).