C11H24O6P2 — CID 14294563
(E)-1,2-bis(diethoxyphosphoryl)prop-1-ene (PubChem CID 14294563) has the molecular formula C11H24O6P2 and a molecular weight of 314.25 g/mol. Its IUPAC name is (E)-1,2-bis(diethoxyphosphoryl)prop-1-ene.
| Compound Name | (E)-1,2-bis(diethoxyphosphoryl)prop-1-ene |
|---|---|
| PubChem CID | 14294563 |
| Molecular Formula | C11H24O6P2 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (E)-1,2-bis(diethoxyphosphoryl)prop-1-ene |
| SMILES | CCOP(=O)(/C=C(\C)P(=O)(OCC)OCC)OCC |
| InChI | InChI=1S/C11H24O6P2/c1-6-14-18(12,15-7-2)10-11(5)19(13,16-8-3)17-9-4/h10H,6-9H2,1-5H3/b11-10+ |
| InChIKey | ZYVKKZFNUDPKFT-ZHACJKMWSA-N |
| XLogP | 4.38 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|