C10H19O6P — CID 134871026
(1E,3Z)-4-diethoxyphosphoryl-1-ethoxybuta-1,3-diene-1,3-diol (PubChem CID 134871026) has the molecular formula C10H19O6P and a molecular weight of 266.23 g/mol. Its IUPAC name is (1E,3Z)-4-diethoxyphosphoryl-1-ethoxybuta-1,3-diene-1,3-diol.
| Compound Name | (1E,3Z)-4-diethoxyphosphoryl-1-ethoxybuta-1,3-diene-1,3-diol |
|---|---|
| PubChem CID | 134871026 |
| Molecular Formula | C10H19O6P |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (1E,3Z)-4-diethoxyphosphoryl-1-ethoxybuta-1,3-diene-1,3-diol |
| SMILES | CCO/C(O)=C/C(O)=C/P(=O)(OCC)OCC |
| InChI | InChI=1S/C10H19O6P/c1-4-14-10(12)7-9(11)8-17(13,15-5-2)16-6-3/h7-8,11-12H,4-6H2,1-3H3/b9-8-,10-7+ |
| InChIKey | SIRFXVLBOKEFDR-ABGYPUNPSA-N |
| XLogP | 3.09 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|