C15H22NO5P — CID 24795550
(E)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphoryl-N,N-dimethylethenamine (PubChem CID 24795550) has the molecular formula C15H22NO5P and a molecular weight of 327.32 g/mol. Its IUPAC name is (E)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphoryl-N,N-dimethylethenamine.
| Compound Name | (E)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphoryl-N,N-dimethylethenamine |
|---|---|
| PubChem CID | 24795550 |
| Molecular Formula | C15H22NO5P |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (E)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphoryl-N,N-dimethylethenamine |
| SMILES | CCOP(=O)(OCC)/C(=C/c1ccc2c(c1)OCO2)N(C)C |
| InChI | InChI=1S/C15H22NO5P/c1-5-20-22(17,21-6-2)15(16(3)4)10-12-7-8-13-14(9-12)19-11-18-13/h7-10H,5-6,11H2,1-4H3/b15-10+ |
| InChIKey | AAUKJOUQOQNFKM-XNTDXEJSSA-N |
| XLogP | 3.54 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|