About 1-[(Z)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphorylethenyl]piperidine
1-[(Z)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphorylethenyl]piperidine (PubChem CID 102119294) has the molecular formula C18H26NO5P
and a molecular weight of 367.38 g/mol. Its IUPAC name is 1-[(Z)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphorylethenyl]piperidine.
Molecular Properties
| Compound Name | 1-[(Z)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphorylethenyl]piperidine |
| PubChem CID | 102119294 |
| Molecular Formula | C18H26NO5P |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-[(Z)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphorylethenyl]piperidine |
| SMILES | CCOP(=O)(OCC)/C(=C\c1ccc2c(c1)OCO2)N1CCCCC1 |
| InChI | InChI=1S/C18H26NO5P/c1-3-23-25(20,24-4-2)18(19-10-6-5-7-11-19)13-15-8-9-16-17(12-15)22-14-21-16/h8-9,12-13H,3-7,10-11,14H2,1-2H3/b18-13- |
| InChIKey | FMBMGPTZWNCELX-AQTBWJFISA-N |
| XLogP | 4.47 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphorylethenyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphorylethenyl]piperidine?
The IUPAC name of 1-[(Z)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphorylethenyl]piperidine (CID 102119294) is 1-[(Z)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphorylethenyl]piperidine.
What is the SMILES notation for 1-[(Z)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphorylethenyl]piperidine?
The canonical SMILES for 1-[(Z)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphorylethenyl]piperidine is CCOP(=O)(OCC)/C(=C\c1ccc2c(c1)OCO2)N1CCCCC1.
What is the InChIKey of 1-[(Z)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphorylethenyl]piperidine?
The InChIKey is FMBMGPTZWNCELX-AQTBWJFISA-N. The full InChI is InChI=1S/C18H26NO5P/c1-3-23-25(20,24-4-2)18(19-10-6-5-7-11-19)13-15-8-9-16-17(12-15)22-14-21-16/h8-9,12-13H,3-7,10-11,14H2,1-2H3/b18-13-.
What are the key properties of 1-[(Z)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphorylethenyl]piperidine?
1-[(Z)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphorylethenyl]piperidine has a molecular weight of 367.38 g/mol, XLogP of 4.47, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphorylethenyl]piperidine is sourced from PubChem (CID 102119294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).