C18H26NO5P — CID 102119294
1-[(Z)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphorylethenyl]piperidine (PubChem CID 102119294) has the molecular formula C18H26NO5P and a molecular weight of 367.38 g/mol. Its IUPAC name is 1-[(Z)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphorylethenyl]piperidine.
| Compound Name | 1-[(Z)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphorylethenyl]piperidine |
|---|---|
| PubChem CID | 102119294 |
| Molecular Formula | C18H26NO5P |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-[(Z)-2-(1,3-benzodioxol-5-yl)-1-diethoxyphosphorylethenyl]piperidine |
| SMILES | CCOP(=O)(OCC)/C(=C\c1ccc2c(c1)OCO2)N1CCCCC1 |
| InChI | InChI=1S/C18H26NO5P/c1-3-23-25(20,24-4-2)18(19-10-6-5-7-11-19)13-15-8-9-16-17(12-15)22-14-21-16/h8-9,12-13H,3-7,10-11,14H2,1-2H3/b18-13- |
| InChIKey | FMBMGPTZWNCELX-AQTBWJFISA-N |
| XLogP | 4.47 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|