C25H26N2O4 — CID 45069140
(E)-N-[(Z)-3-(azepan-1-yl)-1-(1,3-benzodioxol-5-yl)-3-oxoprop-1-en-2-yl]-3-phenylprop-2-enamide (PubChem CID 45069140) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is (E)-N-[(Z)-3-(azepan-1-yl)-1-(1,3-benzodioxol-5-yl)-3-oxoprop-1-en-2-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(Z)-3-(azepan-1-yl)-1-(1,3-benzodioxol-5-yl)-3-oxoprop-1-en-2-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 45069140 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (E)-N-[(Z)-3-(azepan-1-yl)-1-(1,3-benzodioxol-5-yl)-3-oxoprop-1-en-2-yl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)N/C(=C\c1ccc2c(c1)OCO2)C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C25H26N2O4/c28-24(13-11-19-8-4-3-5-9-19)26-21(25(29)27-14-6-1-2-7-15-27)16-20-10-12-22-23(17-20)31-18-30-22/h3-5,8-13,16-17H,1-2,6-7,14-15,18H2,(H,26,28)/b13-11+,21-16- |
| InChIKey | AEDDAHZSLXHNJS-GQWRFYPMSA-N |
| XLogP | 3.99 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|